About 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one
4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one (PubChem CID 142954552) has the molecular formula C23H36O4S
and a molecular weight of 408.60 g/mol. Its IUPAC name is 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one.
Molecular Properties
| Compound Name | 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one |
| PubChem CID | 142954552 |
| Molecular Formula | C23H36O4S |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one |
| SMILES | CCSCCCC(=O)O.COCc1cccc(CCCCC2CCC(=O)C2)c1 |
| InChI | InChI=1S/C17H24O2.C6H12O2S/c1-19-13-16-8-4-7-14(11-16)5-2-3-6-15-9-10-17(18)12-15;1-2-9-5-3-4-6(7)8/h4,7-8,11,15H,2-3,5-6,9-10,12-13H2,1H3;2-5H2,1H3,(H,7,8) |
| InChIKey | VKBZWABDVGSYKO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one?
The IUPAC name of 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one (CID 142954552) is 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one.
What is the SMILES notation for 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one?
The canonical SMILES for 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one is CCSCCCC(=O)O.COCc1cccc(CCCCC2CCC(=O)C2)c1.
What is the InChIKey of 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one?
The InChIKey is VKBZWABDVGSYKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O2.C6H12O2S/c1-19-13-16-8-4-7-14(11-16)5-2-3-6-15-9-10-17(18)12-15;1-2-9-5-3-4-6(7)8/h4,7-8,11,15H,2-3,5-6,9-10,12-13H2,1H3;2-5H2,1H3,(H,7,8).
What are the key properties of 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one?
4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one has a molecular weight of 408.60 g/mol, XLogP of 5.52, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfanylbutanoic acid;3-[4-[3-(methoxymethyl)phenyl]butyl]cyclopentan-1-one is sourced from PubChem (CID 142954552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).