C11H21NO2 — CID 142954564
(2E,4E)-N-ethyl-1,4-dimethoxyhepta-2,4-dien-2-amine (PubChem CID 142954564) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (2E,4E)-N-ethyl-1,4-dimethoxyhepta-2,4-dien-2-amine.
| Compound Name | (2E,4E)-N-ethyl-1,4-dimethoxyhepta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 142954564 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (2E,4E)-N-ethyl-1,4-dimethoxyhepta-2,4-dien-2-amine |
| SMILES | CC/C=C(\C=C(/COC)NCC)OC |
| InChI | InChI=1S/C11H21NO2/c1-5-7-11(14-4)8-10(9-13-3)12-6-2/h7-8,12H,5-6,9H2,1-4H3/b10-8+,11-7+ |
| InChIKey | WVCARLAYQAXJJB-VTTRTIMMSA-N |
| XLogP | 2.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|