C23H21NO2 — CID 142954626
3-[3-(cyclohexa-1,5-dien-1-ylmethoxy)phenyl]-1-[4-(methylamino)phenyl]prop-2-yn-1-one (PubChem CID 142954626) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-[3-(cyclohexa-1,5-dien-1-ylmethoxy)phenyl]-1-[4-(methylamino)phenyl]prop-2-yn-1-one.
| Compound Name | 3-[3-(cyclohexa-1,5-dien-1-ylmethoxy)phenyl]-1-[4-(methylamino)phenyl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 142954626 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3-[3-(cyclohexa-1,5-dien-1-ylmethoxy)phenyl]-1-[4-(methylamino)phenyl]prop-2-yn-1-one |
| SMILES | CNc1ccc(C(=O)C#Cc2cccc(OCC3=CCCC=C3)c2)cc1 |
| InChI | InChI=1S/C23H21NO2/c1-24-21-13-11-20(12-14-21)23(25)15-10-18-8-5-9-22(16-18)26-17-19-6-3-2-4-7-19/h3,5-9,11-14,16,24H,2,4,17H2,1H3 |
| InChIKey | RWMVMHXYUAHRDK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|