About methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine
methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine (PubChem CID 142954655) has the molecular formula C16H35NO3
and a molecular weight of 289.46 g/mol. Its IUPAC name is methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine.
Molecular Properties
| Compound Name | methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine |
| PubChem CID | 142954655 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine |
| SMILES | C1COC(CN2CCCC2)C1.CCCC(C)(C)O.CO |
| InChI | InChI=1S/C9H17NO.C6H14O.CH4O/c1-2-6-10(5-1)8-9-4-3-7-11-9;1-4-5-6(2,3)7;1-2/h9H,1-8H2;7H,4-5H2,1-3H3;2H,1H3 |
| InChIKey | ZFENVXLCCQSDKS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine?
The IUPAC name of methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine (CID 142954655) is methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine.
What is the SMILES notation for methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine?
The canonical SMILES for methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine is C1COC(CN2CCCC2)C1.CCCC(C)(C)O.CO.
What is the InChIKey of methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine?
The InChIKey is ZFENVXLCCQSDKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.C6H14O.CH4O/c1-2-6-10(5-1)8-9-4-3-7-11-9;1-4-5-6(2,3)7;1-2/h9H,1-8H2;7H,4-5H2,1-3H3;2H,1H3.
What are the key properties of methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine?
methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine has a molecular weight of 289.46 g/mol, XLogP of 2.43, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methylpentan-2-ol;1-(oxolan-2-ylmethyl)pyrrolidine is sourced from PubChem (CID 142954655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).