C22H26Cl2N2O3 — CID 142954998
(E)-2-chlorobut-2-ene;ethyl 2-but-3-en-2-yl-1-(2-chlorophenyl)-5-(2-oxoethyl)imidazole-4-carboxylate (PubChem CID 142954998) has the molecular formula C22H26Cl2N2O3 and a molecular weight of 437.37 g/mol. Its IUPAC name is (E)-2-chlorobut-2-ene;ethyl 2-but-3-en-2-yl-1-(2-chlorophenyl)-5-(2-oxoethyl)imidazole-4-carboxylate.
| Compound Name | (E)-2-chlorobut-2-ene;ethyl 2-but-3-en-2-yl-1-(2-chlorophenyl)-5-(2-oxoethyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 142954998 |
| Molecular Formula | C22H26Cl2N2O3 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (E)-2-chlorobut-2-ene;ethyl 2-but-3-en-2-yl-1-(2-chlorophenyl)-5-(2-oxoethyl)imidazole-4-carboxylate |
| SMILES | C/C=C(\C)Cl.C=CC(C)c1nc(C(=O)OCC)c(CC=O)n1-c1ccccc1Cl |
| InChI | InChI=1S/C18H19ClN2O3.C4H7Cl/c1-4-12(3)17-20-16(18(23)24-5-2)15(10-11-22)21(17)14-9-7-6-8-13(14)19;1-3-4(2)5/h4,6-9,11-12H,1,5,10H2,2-3H3;3H,1-2H3/b;4-3+ |
| InChIKey | VRJSASUEIIQIES-SCBDLNNBSA-N |
| XLogP | 5.88 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|