About ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine
ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine (PubChem CID 142955167) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine.
Molecular Properties
| Compound Name | ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine |
| PubChem CID | 142955167 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine |
| SMILES | CC.[H]/N=C/C1=C(C=C)CCN1 |
| InChI | InChI=1S/C7H10N2.C2H6/c1-2-6-3-4-9-7(6)5-8;1-2/h2,5,8-9H,1,3-4H2;1-2H3/b8-5+; |
| InChIKey | QAESAPBDSNVWGU-HAAWTFQLSA-N |
| XLogP | 2.10 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine?
The IUPAC name of ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine (CID 142955167) is ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine.
What is the SMILES notation for ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine?
The canonical SMILES for ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine is CC.[H]/N=C/C1=C(C=C)CCN1.
What is the InChIKey of ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine?
The InChIKey is QAESAPBDSNVWGU-HAAWTFQLSA-N. The full InChI is InChI=1S/C7H10N2.C2H6/c1-2-6-3-4-9-7(6)5-8;1-2/h2,5,8-9H,1,3-4H2;1-2H3/b8-5+;.
What are the key properties of ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine?
ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine has a molecular weight of 152.24 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-ethenyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine is sourced from PubChem (CID 142955167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).