C19H24N2 — CID 142955193
N-[(3Z,8Z)-5,7-dimethylideneundeca-1,3,8,10-tetraen-2-yl]-5-methyl-2,3-dihydropyridin-4-amine (PubChem CID 142955193) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is N-[(3Z,8Z)-5,7-dimethylideneundeca-1,3,8,10-tetraen-2-yl]-5-methyl-2,3-dihydropyridin-4-amine.
| Compound Name | N-[(3Z,8Z)-5,7-dimethylideneundeca-1,3,8,10-tetraen-2-yl]-5-methyl-2,3-dihydropyridin-4-amine |
|---|---|
| PubChem CID | 142955193 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-[(3Z,8Z)-5,7-dimethylideneundeca-1,3,8,10-tetraen-2-yl]-5-methyl-2,3-dihydropyridin-4-amine |
| SMILES | C=C/C=C\C(=C)CC(=C)/C=C\C(=C)NC1=C(C)C=NCC1 |
| InChI | InChI=1S/C19H24N2/c1-6-7-8-15(2)13-16(3)9-10-18(5)21-19-11-12-20-14-17(19)4/h6-10,14,21H,1-3,5,11-13H2,4H3/b8-7-,10-9- |
| InChIKey | HZUXAZWBAYIQAH-QRLRYFCNSA-N |
| XLogP | 4.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|