C12H14N2O4 — CID 142955384
3-(formylcarbamoyl)-2-(propylamino)benzoic acid (PubChem CID 142955384) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 3-(formylcarbamoyl)-2-(propylamino)benzoic acid.
| Compound Name | 3-(formylcarbamoyl)-2-(propylamino)benzoic acid |
|---|---|
| PubChem CID | 142955384 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-(formylcarbamoyl)-2-(propylamino)benzoic acid |
| SMILES | CCCNc1c(C(=O)O)cccc1C(=O)NC=O |
| InChI | InChI=1S/C12H14N2O4/c1-2-6-13-10-8(11(16)14-7-15)4-3-5-9(10)12(17)18/h3-5,7,13H,2,6H2,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | ISERUXGXNGXXQO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|