C18H22N2O2S — CID 142955508
ethane;N-[(4-methylphenyl)methylcarbamoyl]-2-sulfanylbenzamide (PubChem CID 142955508) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is ethane;N-[(4-methylphenyl)methylcarbamoyl]-2-sulfanylbenzamide.
| Compound Name | ethane;N-[(4-methylphenyl)methylcarbamoyl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 142955508 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | ethane;N-[(4-methylphenyl)methylcarbamoyl]-2-sulfanylbenzamide |
| SMILES | CC.Cc1ccc(CNC(=O)NC(=O)c2ccccc2S)cc1 |
| InChI | InChI=1S/C16H16N2O2S.C2H6/c1-11-6-8-12(9-7-11)10-17-16(20)18-15(19)13-4-2-3-5-14(13)21;1-2/h2-9,21H,10H2,1H3,(H2,17,18,19,20);1-2H3 |
| InChIKey | XAJLRUOQYWEYJK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|