About 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine
5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine (PubChem CID 142955539) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine |
| PubChem CID | 142955539 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine |
| SMILES | CCN1C=c2cc[nH]c2=CC1 |
| InChI | InChI=1S/C9H12N2/c1-2-11-6-4-9-8(7-11)3-5-10-9/h3-5,7,10H,2,6H2,1H3 |
| InChIKey | HFOSAPJFARKSDF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine?
The IUPAC name of 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine (CID 142955539) is 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine.
What is the SMILES notation for 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine?
The canonical SMILES for 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine is CCN1C=c2cc[nH]c2=CC1.
What is the InChIKey of 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine?
The InChIKey is HFOSAPJFARKSDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-2-11-6-4-9-8(7-11)3-5-10-9/h3-5,7,10H,2,6H2,1H3.
What are the key properties of 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine?
5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine has a molecular weight of 148.21 g/mol, XLogP of -0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,6-dihydropyrrolo[3,2-c]pyridine is sourced from PubChem (CID 142955539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).