C36H58IN4O5P — CID 142957533
2-[6-[2-cyanoethoxy-[methyl(propan-2-yl)amino]phosphanyl]oxy-3,3-dimethyl-2-[(3E)-3-[1-(methylamino)ethylidene]-8-(3-oxo-1H-isoindol-2-yl)octyl]cyclohexyl]ethoxy hypoiodite (PubChem CID 142957533) has the molecular formula C36H58IN4O5P and a molecular weight of 784.76 g/mol. Its IUPAC name is 2-[6-[2-cyanoethoxy-[methyl(propan-2-yl)amino]phosphanyl]oxy-3,3-dimethyl-2-[(3E)-3-[1-(methylamino)ethylidene]-8-(3-oxo-1H-isoindol-2-yl)octyl]cyclohexyl]ethoxy hypoiodite.
| Compound Name | 2-[6-[2-cyanoethoxy-[methyl(propan-2-yl)amino]phosphanyl]oxy-3,3-dimethyl-2-[(3E)-3-[1-(methylamino)ethylidene]-8-(3-oxo-1H-isoindol-2-yl)octyl]cyclohexyl]ethoxy hypoiodite |
|---|---|
| PubChem CID | 142957533 |
| Molecular Formula | C36H58IN4O5P |
| Molecular Weight | 784.76 g/mol |
| Exact Mass | 784.32 |
| IUPAC Name | 2-[6-[2-cyanoethoxy-[methyl(propan-2-yl)amino]phosphanyl]oxy-3,3-dimethyl-2-[(3E)-3-[1-(methylamino)ethylidene]-8-(3-oxo-1H-isoindol-2-yl)octyl]cyclohexyl]ethoxy hypoiodite |
| SMILES | CN/C(C)=C(\CCCCCN1Cc2ccccc2C1=O)CCC1C(CCOOI)C(OP(OCCC#N)N(C)C(C)C)CCC1(C)C |
| InChI | InChI=1S/C36H58IN4O5P/c1-27(2)40(7)47(44-24-13-22-38)45-34-19-21-36(4,5)33(32(34)20-25-43-46-37)18-17-29(28(3)39-6)14-9-8-12-23-41-26-30-15-10-11-16-31(30)35(41)42/h10-11,15-16,27,32-34,39H,8-9,12-14,17-21,23-26H2,1-7H3/b29-28+ |
| InChIKey | IGZSOSXDVFFXMZ-ZQHSETAFSA-N |
| XLogP | 9.10 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.76 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|