About (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole
(5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole (PubChem CID 142958046) has the molecular formula C14H14F2N2
and a molecular weight of 248.28 g/mol. Its IUPAC name is (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole.
Molecular Properties
| Compound Name | (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole |
| PubChem CID | 142958046 |
| Molecular Formula | C14H14F2N2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole |
| SMILES | CC(C)=C/C=C1\CC(c2cc(F)cc(F)c2)=NN1 |
| InChI | InChI=1S/C14H14F2N2/c1-9(2)3-4-13-8-14(18-17-13)10-5-11(15)7-12(16)6-10/h3-7,17H,8H2,1-2H3/b13-4+ |
| InChIKey | XRABRYQWPDRHQG-YIXHJXPBSA-N |
| XLogP | 3.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole?
The IUPAC name of (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole (CID 142958046) is (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole.
What is the SMILES notation for (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole?
The canonical SMILES for (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole is CC(C)=C/C=C1\CC(c2cc(F)cc(F)c2)=NN1.
What is the InChIKey of (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole?
The InChIKey is XRABRYQWPDRHQG-YIXHJXPBSA-N. The full InChI is InChI=1S/C14H14F2N2/c1-9(2)3-4-13-8-14(18-17-13)10-5-11(15)7-12(16)6-10/h3-7,17H,8H2,1-2H3/b13-4+.
What are the key properties of (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole?
(5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole has a molecular weight of 248.28 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-3-(3,5-difluorophenyl)-5-(3-methylbut-2-enylidene)-1,4-dihydropyrazole is sourced from PubChem (CID 142958046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).