C19H19N5O2 — CID 142958156
acetaldehyde;formaldehyde;3-(4-methylphenyl)-5-(1H-1,2,4-triazol-5-yl)-1H-indazole (PubChem CID 142958156) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is acetaldehyde;formaldehyde;3-(4-methylphenyl)-5-(1H-1,2,4-triazol-5-yl)-1H-indazole.
| Compound Name | acetaldehyde;formaldehyde;3-(4-methylphenyl)-5-(1H-1,2,4-triazol-5-yl)-1H-indazole |
|---|---|
| PubChem CID | 142958156 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | acetaldehyde;formaldehyde;3-(4-methylphenyl)-5-(1H-1,2,4-triazol-5-yl)-1H-indazole |
| SMILES | C=O.CC=O.Cc1ccc(-c2n[nH]c3ccc(-c4ncn[nH]4)cc23)cc1 |
| InChI | InChI=1S/C16H13N5.C2H4O.CH2O/c1-10-2-4-11(5-3-10)15-13-8-12(16-17-9-18-21-16)6-7-14(13)19-20-15;1-2-3;1-2/h2-9H,1H3,(H,19,20)(H,17,18,21);2H,1H3;1H2 |
| InChIKey | WPQCWAAKZNCZSL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|