C20H27FN3O+ — CID 142958466
[(1S,7aS)-1-(aminomethyl)-1-(2-hydroxyethyl)-6-methanimidoyl-7a-methyl-3,7-dihydro-2H-inden-5-yl]-(4-fluorophenyl)azanium (PubChem CID 142958466) has the molecular formula C20H27FN3O+ and a molecular weight of 344.45 g/mol. Its IUPAC name is [(1S,7aS)-1-(aminomethyl)-1-(2-hydroxyethyl)-6-methanimidoyl-7a-methyl-3,7-dihydro-2H-inden-5-yl]-(4-fluorophenyl)azanium.
| Compound Name | [(1S,7aS)-1-(aminomethyl)-1-(2-hydroxyethyl)-6-methanimidoyl-7a-methyl-3,7-dihydro-2H-inden-5-yl]-(4-fluorophenyl)azanium |
|---|---|
| PubChem CID | 142958466 |
| Molecular Formula | C20H27FN3O+ |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | [(1S,7aS)-1-(aminomethyl)-1-(2-hydroxyethyl)-6-methanimidoyl-7a-methyl-3,7-dihydro-2H-inden-5-yl]-(4-fluorophenyl)azanium |
| SMILES | [H]/N=C/C1=C([NH2+]c2ccc(F)cc2)C=C2CC[C@](CN)(CCO)[C@@]2(C)C1 |
| InChI | InChI=1S/C20H26FN3O/c1-19-11-14(12-22)18(24-17-4-2-16(21)3-5-17)10-15(19)6-7-20(19,13-23)8-9-25/h2-5,10,12,22,24-25H,6-9,11,13,23H2,1H3/p+1/b22-12+/t19-,20+/m0/s1 |
| InChIKey | UFKZWTPLQTVPLL-CFCUBEPFSA-O |
| XLogP | 2.38 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|