C15H27N3O — CID 142958887
(2E,4E)-5-amino-N-[2-(diethylamino)ethyl]-2-methylocta-2,4,7-trienamide (PubChem CID 142958887) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is (2E,4E)-5-amino-N-[2-(diethylamino)ethyl]-2-methylocta-2,4,7-trienamide.
| Compound Name | (2E,4E)-5-amino-N-[2-(diethylamino)ethyl]-2-methylocta-2,4,7-trienamide |
|---|---|
| PubChem CID | 142958887 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | (2E,4E)-5-amino-N-[2-(diethylamino)ethyl]-2-methylocta-2,4,7-trienamide |
| SMILES | C=CC/C(N)=C\C=C(/C)C(=O)NCCN(CC)CC |
| InChI | InChI=1S/C15H27N3O/c1-5-8-14(16)10-9-13(4)15(19)17-11-12-18(6-2)7-3/h5,9-10H,1,6-8,11-12,16H2,2-4H3,(H,17,19)/b13-9+,14-10+ |
| InChIKey | IYEVWDMHARNECA-UTLPMFLDSA-N |
| XLogP | 1.81 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|