C18H19FN2O2S — CID 142958897
4-fluoro-1-(4-methylsulfonylphenyl)-2-[(2E,4E,6Z)-octa-2,4,6-trien-4-yl]imidazole (PubChem CID 142958897) has the molecular formula C18H19FN2O2S and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-fluoro-1-(4-methylsulfonylphenyl)-2-[(2E,4E,6Z)-octa-2,4,6-trien-4-yl]imidazole.
| Compound Name | 4-fluoro-1-(4-methylsulfonylphenyl)-2-[(2E,4E,6Z)-octa-2,4,6-trien-4-yl]imidazole |
|---|---|
| PubChem CID | 142958897 |
| Molecular Formula | C18H19FN2O2S |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 4-fluoro-1-(4-methylsulfonylphenyl)-2-[(2E,4E,6Z)-octa-2,4,6-trien-4-yl]imidazole |
| SMILES | C/C=C\C=C(/C=C/C)c1nc(F)cn1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H19FN2O2S/c1-4-6-8-14(7-5-2)18-20-17(19)13-21(18)15-9-11-16(12-10-15)24(3,22)23/h4-13H,1-3H3/b6-4-,7-5+,14-8+ |
| InChIKey | DZYAIKAPLQFSIT-GYZDKPECSA-N |
| XLogP | 3.95 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|