About 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine
1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine (PubChem CID 142959112) has the molecular formula C13H18FN3
and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine |
| PubChem CID | 142959112 |
| Molecular Formula | C13H18FN3 |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccc(N2CC=NCC2)c(F)c1 |
| InChI | InChI=1S/C13H18FN3/c1-16(2)10-11-3-4-13(12(14)9-11)17-7-5-15-6-8-17/h3-5,9H,6-8,10H2,1-2H3 |
| InChIKey | CSKDGMMACRUSTM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine (CID 142959112) is 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine is CN(C)Cc1ccc(N2CC=NCC2)c(F)c1.
What is the InChIKey of 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine?
The InChIKey is CSKDGMMACRUSTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FN3/c1-16(2)10-11-3-4-13(12(14)9-11)17-7-5-15-6-8-17/h3-5,9H,6-8,10H2,1-2H3.
What are the key properties of 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine?
1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine has a molecular weight of 235.31 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,5-dihydro-2H-pyrazin-4-yl)-3-fluorophenyl]-N,N-dimethylmethanamine is sourced from PubChem (CID 142959112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).