About fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane
fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane (PubChem CID 142959151) has the molecular formula C16H21F3O3
and a molecular weight of 318.34 g/mol. Its IUPAC name is fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane.
Molecular Properties
| Compound Name | fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane |
| PubChem CID | 142959151 |
| Molecular Formula | C16H21F3O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane |
| SMILES | CCF.CF.Cc1ccc2c(c1)C=C(C(=O)O)C(C(C)F)O2 |
| InChI | InChI=1S/C13H13FO3.C2H5F.CH3F/c1-7-3-4-11-9(5-7)6-10(13(15)16)12(17-11)8(2)14;1-2-3;1-2/h3-6,8,12H,1-2H3,(H,15,16);2H2,1H3;1H3 |
| InChIKey | CDQWIRRCHBNDAI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane?
The IUPAC name of fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane (CID 142959151) is fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane.
What is the SMILES notation for fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane?
The canonical SMILES for fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane is CCF.CF.Cc1ccc2c(c1)C=C(C(=O)O)C(C(C)F)O2.
What is the InChIKey of fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane?
The InChIKey is CDQWIRRCHBNDAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FO3.C2H5F.CH3F/c1-7-3-4-11-9(5-7)6-10(13(15)16)12(17-11)8(2)14;1-2-3;1-2/h3-6,8,12H,1-2H3,(H,15,16);2H2,1H3;1H3.
What are the key properties of fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane?
fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane has a molecular weight of 318.34 g/mol, XLogP of 4.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroethane;2-(1-fluoroethyl)-6-methyl-2H-chromene-3-carboxylic acid;fluoromethane is sourced from PubChem (CID 142959151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).