C21H25F3N2O2S — CID 142959221
acetylene;difluoromethane;4-(fluoromethyl)-2-[(3Z,5Z)-hepta-3,5-dien-2-yl]-1-(4-methylsulfonylphenyl)imidazole (PubChem CID 142959221) has the molecular formula C21H25F3N2O2S and a molecular weight of 426.50 g/mol. Its IUPAC name is acetylene;difluoromethane;4-(fluoromethyl)-2-[(3Z,5Z)-hepta-3,5-dien-2-yl]-1-(4-methylsulfonylphenyl)imidazole.
| Compound Name | acetylene;difluoromethane;4-(fluoromethyl)-2-[(3Z,5Z)-hepta-3,5-dien-2-yl]-1-(4-methylsulfonylphenyl)imidazole |
|---|---|
| PubChem CID | 142959221 |
| Molecular Formula | C21H25F3N2O2S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | acetylene;difluoromethane;4-(fluoromethyl)-2-[(3Z,5Z)-hepta-3,5-dien-2-yl]-1-(4-methylsulfonylphenyl)imidazole |
| SMILES | C#C.C/C=C\C=C/C(C)c1nc(CF)cn1-c1ccc(S(C)(=O)=O)cc1.FCF |
| InChI | InChI=1S/C18H21FN2O2S.C2H2.CH2F2/c1-4-5-6-7-14(2)18-20-15(12-19)13-21(18)16-8-10-17(11-9-16)24(3,22)23;1-2;2-1-3/h4-11,13-14H,12H2,1-3H3;1-2H;1H2/b5-4-,7-6-;; |
| InChIKey | LATYJTKDHIQFER-FCVIEVJZSA-N |
| XLogP | 5.11 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|