About 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine
3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine (PubChem CID 142959398) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine.
Molecular Properties
| Compound Name | 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine |
| PubChem CID | 142959398 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine |
| SMILES | Cc1nnc2c(n1)C=CC(C)C=C2 |
| InChI | InChI=1S/C10H11N3/c1-7-3-5-9-10(6-4-7)13-12-8(2)11-9/h3-7H,1-2H3 |
| InChIKey | RTQWHLSYWFAGTK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine?
The IUPAC name of 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine (CID 142959398) is 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine.
What is the SMILES notation for 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine?
The canonical SMILES for 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine is Cc1nnc2c(n1)C=CC(C)C=C2.
What is the InChIKey of 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine?
The InChIKey is RTQWHLSYWFAGTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-7-3-5-9-10(6-4-7)13-12-8(2)11-9/h3-7H,1-2H3.
What are the key properties of 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine?
3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine has a molecular weight of 173.22 g/mol, XLogP of 1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-7H-cyclohepta[e][1,2,4]triazine is sourced from PubChem (CID 142959398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).