About acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide
acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide (PubChem CID 142959973) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide.
Molecular Properties
| Compound Name | acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide |
| PubChem CID | 142959973 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide |
| SMILES | C#C.CC(=O)NCC/C(N)=C/N(C)C(C)C |
| InChI | InChI=1S/C10H21N3O.C2H2/c1-8(2)13(4)7-10(11)5-6-12-9(3)14;1-2/h7-8H,5-6,11H2,1-4H3,(H,12,14);1-2H/b10-7-; |
| InChIKey | VGPWNBCKHCCJES-VEZAGKLZSA-N |
| XLogP | 0.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide?
The IUPAC name of acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide (CID 142959973) is acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide.
What is the SMILES notation for acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide?
The canonical SMILES for acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide is C#C.CC(=O)NCC/C(N)=C/N(C)C(C)C.
What is the InChIKey of acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide?
The InChIKey is VGPWNBCKHCCJES-VEZAGKLZSA-N. The full InChI is InChI=1S/C10H21N3O.C2H2/c1-8(2)13(4)7-10(11)5-6-12-9(3)14;1-2/h7-8H,5-6,11H2,1-4H3,(H,12,14);1-2H/b10-7-;.
What are the key properties of acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide?
acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide has a molecular weight of 225.34 g/mol, XLogP of 0.90, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;N-[(Z)-3-amino-4-[methyl(propan-2-yl)amino]but-3-enyl]acetamide is sourced from PubChem (CID 142959973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).