C23H35FO3 — CID 142960131
(13'S,17'R)-17'-fluoro-13'-methyl-5'-propylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-10'-ol (PubChem CID 142960131) has the molecular formula C23H35FO3 and a molecular weight of 378.53 g/mol. Its IUPAC name is (13'S,17'R)-17'-fluoro-13'-methyl-5'-propylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-10'-ol.
| Compound Name | (13'S,17'R)-17'-fluoro-13'-methyl-5'-propylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-10'-ol |
|---|---|
| PubChem CID | 142960131 |
| Molecular Formula | C23H35FO3 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (13'S,17'R)-17'-fluoro-13'-methyl-5'-propylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-10'-ol |
| SMILES | CCCC12CCC3C(=CC[C@@]4(C)C3CC[C@H]4F)C1(O)CCC1(C2)OCCO1 |
| InChI | InChI=1S/C23H35FO3/c1-3-8-21-10-6-16-17-4-5-19(24)20(17,2)9-7-18(16)23(21,25)12-11-22(15-21)26-13-14-27-22/h7,16-17,19,25H,3-6,8-15H2,1-2H3/t16?,17?,19-,20+,21?,23?/m1/s1 |
| InChIKey | CNKAGHWMBZAPBF-NWFOKOSUSA-N |
| XLogP | 4.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|