C22H36O2 — CID 142960171
ethane;(3S)-3-ethoxy-13-methyl-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 142960171) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is ethane;(3S)-3-ethoxy-13-methyl-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | ethane;(3S)-3-ethoxy-13-methyl-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 142960171 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | ethane;(3S)-3-ethoxy-13-methyl-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC.CCO[C@@]1(O)CCC2=C(CCC3C2=CCC2(C)CCCC32)C1 |
| InChI | InChI=1S/C20H30O2.C2H6/c1-3-22-20(21)12-9-15-14(13-20)6-7-17-16(15)8-11-19(2)10-4-5-18(17)19;1-2/h8,17-18,21H,3-7,9-13H2,1-2H3;1-2H3/t17?,18?,19?,20-;/m0./s1 |
| InChIKey | AHPRMSQKTUKJKS-WEARROQMSA-N |
| XLogP | 5.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|