About 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane
8-fluoro-1-thia-4,8-diazaspiro[4.5]decane (PubChem CID 142960298) has the molecular formula C7H13FN2S
and a molecular weight of 176.26 g/mol. Its IUPAC name is 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane |
| PubChem CID | 142960298 |
| Molecular Formula | C7H13FN2S |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane |
| SMILES | FN1CCC2(CC1)NCCS2 |
| InChI | InChI=1S/C7H13FN2S/c8-10-4-1-7(2-5-10)9-3-6-11-7/h9H,1-6H2 |
| InChIKey | HUQBEUYOXZRLCL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane?
The IUPAC name of 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane (CID 142960298) is 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane.
What is the SMILES notation for 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane?
The canonical SMILES for 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane is FN1CCC2(CC1)NCCS2.
What is the InChIKey of 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane?
The InChIKey is HUQBEUYOXZRLCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FN2S/c8-10-4-1-7(2-5-10)9-3-6-11-7/h9H,1-6H2.
What are the key properties of 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane?
8-fluoro-1-thia-4,8-diazaspiro[4.5]decane has a molecular weight of 176.26 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-1-thia-4,8-diazaspiro[4.5]decane is sourced from PubChem (CID 142960298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).