C27H41F2N7O3 — CID 142960343
difluoromethane;ethyl 1-[5-(2-butoxyethylamino)-4-ethanimidoyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-2-yl]piperidine-4-carboxylate (PubChem CID 142960343) has the molecular formula C27H41F2N7O3 and a molecular weight of 549.67 g/mol. Its IUPAC name is difluoromethane;ethyl 1-[5-(2-butoxyethylamino)-4-ethanimidoyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-2-yl]piperidine-4-carboxylate.
| Compound Name | difluoromethane;ethyl 1-[5-(2-butoxyethylamino)-4-ethanimidoyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 142960343 |
| Molecular Formula | C27H41F2N7O3 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | difluoromethane;ethyl 1-[5-(2-butoxyethylamino)-4-ethanimidoyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-2-yl]piperidine-4-carboxylate |
| SMILES | FCF.[H]/N=C(\C)c1nc(N2CCC(C(=O)OCC)CC2)nc(Nc2cc(C)ccn2)c1NCCOCCCC |
| InChI | InChI=1S/C26H39N7O3.CH2F2/c1-5-7-15-35-16-12-29-23-22(19(4)27)31-26(32-24(23)30-21-17-18(3)8-11-28-21)33-13-9-20(10-14-33)25(34)36-6-2;2-1-3/h8,11,17,20,27,29H,5-7,9-10,12-16H2,1-4H3,(H,28,30,31,32);1H2/b27-19+; |
| InChIKey | JNNCXDUTTLGEAK-MHJOWNCHSA-N |
| XLogP | 5.20 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|