C23H38O6 — CID 142960514
5-hydroxy-7-(6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)heptanoic acid;2-methylbutanoic acid (PubChem CID 142960514) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is 5-hydroxy-7-(6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)heptanoic acid;2-methylbutanoic acid.
| Compound Name | 5-hydroxy-7-(6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)heptanoic acid;2-methylbutanoic acid |
|---|---|
| PubChem CID | 142960514 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 5-hydroxy-7-(6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)heptanoic acid;2-methylbutanoic acid |
| SMILES | CC1C=CC2=CC(O)CCC2C1CCC(O)CCCC(=O)O.CCC(C)C(=O)O |
| InChI | InChI=1S/C18H28O4.C5H10O2/c1-12-5-6-13-11-15(20)8-10-17(13)16(12)9-7-14(19)3-2-4-18(21)22;1-3-4(2)5(6)7/h5-6,11-12,14-17,19-20H,2-4,7-10H2,1H3,(H,21,22);4H,3H2,1-2H3,(H,6,7) |
| InChIKey | DPJZUPSZMVUGGR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |