C9H14N2O — CID 142960531
molecular hydrogen;N-pyridin-2-ylbutanamide (PubChem CID 142960531) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is molecular hydrogen;N-pyridin-2-ylbutanamide.
| Compound Name | molecular hydrogen;N-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 142960531 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | molecular hydrogen;N-pyridin-2-ylbutanamide |
| SMILES | CCCC(=O)Nc1ccccn1.[H][H] |
| InChI | InChI=1S/C9H12N2O.H2/c1-2-5-9(12)11-8-6-3-4-7-10-8;/h3-4,6-7H,2,5H2,1H3,(H,10,11,12);1H |
| InChIKey | PVVBNONFBLOBHD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |