About methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde
methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde (PubChem CID 142960710) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde.
Molecular Properties
| Compound Name | methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde |
| PubChem CID | 142960710 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde |
| SMILES | CC(C)Oc1ccnc(C=O)n1.COC |
| InChI | InChI=1S/C8H10N2O2.C2H6O/c1-6(2)12-8-3-4-9-7(5-11)10-8;1-3-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | HZVMAGUEEZFCII-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde?
The IUPAC name of methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde (CID 142960710) is methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde.
What is the SMILES notation for methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde?
The canonical SMILES for methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde is CC(C)Oc1ccnc(C=O)n1.COC.
What is the InChIKey of methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde?
The InChIKey is HZVMAGUEEZFCII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2.C2H6O/c1-6(2)12-8-3-4-9-7(5-11)10-8;1-3-2/h3-6H,1-2H3;1-2H3.
What are the key properties of methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde?
methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde has a molecular weight of 212.25 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;4-propan-2-yloxypyrimidine-2-carbaldehyde is sourced from PubChem (CID 142960710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).