About ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine
ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine (PubChem CID 142961076) has the molecular formula C16H35N3
and a molecular weight of 269.48 g/mol. Its IUPAC name is ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine.
Molecular Properties
| Compound Name | ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine |
| PubChem CID | 142961076 |
| Molecular Formula | C16H35N3 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.28 |
| IUPAC Name | ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine |
| SMILES | C/C=C\C=C/CCN1CCC(NC)CC1.CC.CN |
| InChI | InChI=1S/C13H24N2.C2H6.CH5N/c1-3-4-5-6-7-10-15-11-8-13(14-2)9-12-15;2*1-2/h3-6,13-14H,7-12H2,1-2H3;1-2H3;2H2,1H3/b4-3-,6-5-;; |
| InChIKey | KGBXZNIPENSWIO-QNQCLSKXSA-N |
| XLogP | 2.79 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine?
The IUPAC name of ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine (CID 142961076) is ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine.
What is the SMILES notation for ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine?
The canonical SMILES for ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine is C/C=C\C=C/CCN1CCC(NC)CC1.CC.CN.
What is the InChIKey of ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine?
The InChIKey is KGBXZNIPENSWIO-QNQCLSKXSA-N. The full InChI is InChI=1S/C13H24N2.C2H6.CH5N/c1-3-4-5-6-7-10-15-11-8-13(14-2)9-12-15;2*1-2/h3-6,13-14H,7-12H2,1-2H3;1-2H3;2H2,1H3/b4-3-,6-5-;;.
What are the key properties of ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine?
ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine has a molecular weight of 269.48 g/mol, XLogP of 2.79, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(3Z,5Z)-hepta-3,5-dienyl]-N-methylpiperidin-4-amine;methanamine is sourced from PubChem (CID 142961076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).