About ethane;S-(2-oxopentan-3-yl) ethanethioate
ethane;S-(2-oxopentan-3-yl) ethanethioate (PubChem CID 142961121) has the molecular formula C9H18O2S
and a molecular weight of 190.31 g/mol. Its IUPAC name is ethane;S-(2-oxopentan-3-yl) ethanethioate.
Molecular Properties
| Compound Name | ethane;S-(2-oxopentan-3-yl) ethanethioate |
| PubChem CID | 142961121 |
| Molecular Formula | C9H18O2S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | ethane;S-(2-oxopentan-3-yl) ethanethioate |
| SMILES | CC.CCC(SC(C)=O)C(C)=O |
| InChI | InChI=1S/C7H12O2S.C2H6/c1-4-7(5(2)8)10-6(3)9;1-2/h7H,4H2,1-3H3;1-2H3 |
| InChIKey | PQRRHAHYUHHSFY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethane;S-(2-oxopentan-3-yl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;S-(2-oxopentan-3-yl) ethanethioate?
The IUPAC name of ethane;S-(2-oxopentan-3-yl) ethanethioate (CID 142961121) is ethane;S-(2-oxopentan-3-yl) ethanethioate.
What is the SMILES notation for ethane;S-(2-oxopentan-3-yl) ethanethioate?
The canonical SMILES for ethane;S-(2-oxopentan-3-yl) ethanethioate is CC.CCC(SC(C)=O)C(C)=O.
What is the InChIKey of ethane;S-(2-oxopentan-3-yl) ethanethioate?
The InChIKey is PQRRHAHYUHHSFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2S.C2H6/c1-4-7(5(2)8)10-6(3)9;1-2/h7H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;S-(2-oxopentan-3-yl) ethanethioate?
ethane;S-(2-oxopentan-3-yl) ethanethioate has a molecular weight of 190.31 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;S-(2-oxopentan-3-yl) ethanethioate is sourced from PubChem (CID 142961121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).