C25H42N7P — CID 142961128
4-N-heptan-4-yl-6-N-(1-methylpiperidin-4-yl)-2-N-(3-phosphanyl-4-propylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 142961128) has the molecular formula C25H42N7P and a molecular weight of 471.63 g/mol. Its IUPAC name is 4-N-heptan-4-yl-6-N-(1-methylpiperidin-4-yl)-2-N-(3-phosphanyl-4-propylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-heptan-4-yl-6-N-(1-methylpiperidin-4-yl)-2-N-(3-phosphanyl-4-propylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 142961128 |
| Molecular Formula | C25H42N7P |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | 4-N-heptan-4-yl-6-N-(1-methylpiperidin-4-yl)-2-N-(3-phosphanyl-4-propylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCc1ccc(Nc2nc(NC(CCC)CCC)nc(NC3CCN(C)CC3)n2)cc1P |
| InChI | InChI=1S/C25H42N7P/c1-5-8-18-11-12-21(17-22(18)33)28-25-30-23(26-19(9-6-2)10-7-3)29-24(31-25)27-20-13-15-32(4)16-14-20/h11-12,17,19-20H,5-10,13-16,33H2,1-4H3,(H3,26,27,28,29,30,31) |
| InChIKey | ZBIRUUCCMFYSKT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|