About butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide
butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide (PubChem CID 142961169) has the molecular formula C18H35N3
and a molecular weight of 293.50 g/mol. Its IUPAC name is butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide.
Molecular Properties
| Compound Name | butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide |
| PubChem CID | 142961169 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide |
| SMILES | C=C(C)N/C(C)=N/C(C)=N/C1CCCCCC1.CCCC |
| InChI | InChI=1S/C14H25N3.C4H10/c1-11(2)15-12(3)16-13(4)17-14-9-7-5-6-8-10-14;1-3-4-2/h14H,1,5-10H2,2-4H3,(H,15,16,17);3-4H2,1-2H3 |
| InChIKey | YTXNXMQPNDRKEY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide?
The IUPAC name of butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide (CID 142961169) is butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide.
What is the SMILES notation for butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide?
The canonical SMILES for butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide is C=C(C)N/C(C)=N/C(C)=N/C1CCCCCC1.CCCC.
What is the InChIKey of butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide?
The InChIKey is YTXNXMQPNDRKEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3.C4H10/c1-11(2)15-12(3)16-13(4)17-14-9-7-5-6-8-10-14;1-3-4-2/h14H,1,5-10H2,2-4H3,(H,15,16,17);3-4H2,1-2H3.
What are the key properties of butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide?
butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide has a molecular weight of 293.50 g/mol, XLogP of 5.48, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;N'-(N-cycloheptyl-C-methylcarbonimidoyl)-N-prop-1-en-2-ylethanimidamide is sourced from PubChem (CID 142961169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).