C18H26FN5O2 — CID 142961202
6-(2-fluorophenyl)peroxy-4-N-methyl-2-N-octan-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 142961202) has the molecular formula C18H26FN5O2 and a molecular weight of 363.44 g/mol. Its IUPAC name is 6-(2-fluorophenyl)peroxy-4-N-methyl-2-N-octan-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-fluorophenyl)peroxy-4-N-methyl-2-N-octan-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 142961202 |
| Molecular Formula | C18H26FN5O2 |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 6-(2-fluorophenyl)peroxy-4-N-methyl-2-N-octan-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCC(CCC)Nc1nc(NC)nc(OOc2ccccc2F)n1 |
| InChI | InChI=1S/C18H26FN5O2/c1-4-6-10-13(9-5-2)21-17-22-16(20-3)23-18(24-17)26-25-15-12-8-7-11-14(15)19/h7-8,11-13H,4-6,9-10H2,1-3H3,(H2,20,21,22,23,24) |
| InChIKey | NWASKMPHHAWQOU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|