C13H17NO — CID 142961800
2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol (PubChem CID 142961800) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol.
| Compound Name | 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol |
|---|---|
| PubChem CID | 142961800 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol |
| SMILES | C=Cc1cc(/C=C/C)cnc1C=C.CO |
| InChI | InChI=1S/C12H13N.CH4O/c1-4-7-10-8-11(5-2)12(6-3)13-9-10;1-2/h4-9H,2-3H2,1H3;2H,1H3/b7-4+; |
| InChIKey | QRWOVGVZUZKUGM-KQGICBIGSA-N |
| XLogP | 3.01 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |