About 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol
2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol (PubChem CID 142961800) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol |
| PubChem CID | 142961800 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol |
| SMILES | C=Cc1cc(/C=C/C)cnc1C=C.CO |
| InChI | InChI=1S/C12H13N.CH4O/c1-4-7-10-8-11(5-2)12(6-3)13-9-10;1-2/h4-9H,2-3H2,1H3;2H,1H3/b7-4+; |
| InChIKey | QRWOVGVZUZKUGM-KQGICBIGSA-N |
| XLogP | 3.01 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol?
The IUPAC name of 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol (CID 142961800) is 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol.
What is the SMILES notation for 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol?
The canonical SMILES for 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol is C=Cc1cc(/C=C/C)cnc1C=C.CO.
What is the InChIKey of 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol?
The InChIKey is QRWOVGVZUZKUGM-KQGICBIGSA-N. The full InChI is InChI=1S/C12H13N.CH4O/c1-4-7-10-8-11(5-2)12(6-3)13-9-10;1-2/h4-9H,2-3H2,1H3;2H,1H3/b7-4+;.
What are the key properties of 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol?
2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol has a molecular weight of 203.28 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-5-[(E)-prop-1-enyl]pyridine;methanol is sourced from PubChem (CID 142961800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).