C30H29N3O — CID 142961849
acetylene;2-methoxy-5-[1-[(2E,4Z)-2-methyl-1,1-diphenylhexa-2,4-dienyl]imidazol-4-yl]pyridine (PubChem CID 142961849) has the molecular formula C30H29N3O and a molecular weight of 447.58 g/mol. Its IUPAC name is acetylene;2-methoxy-5-[1-[(2E,4Z)-2-methyl-1,1-diphenylhexa-2,4-dienyl]imidazol-4-yl]pyridine.
| Compound Name | acetylene;2-methoxy-5-[1-[(2E,4Z)-2-methyl-1,1-diphenylhexa-2,4-dienyl]imidazol-4-yl]pyridine |
|---|---|
| PubChem CID | 142961849 |
| Molecular Formula | C30H29N3O |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | acetylene;2-methoxy-5-[1-[(2E,4Z)-2-methyl-1,1-diphenylhexa-2,4-dienyl]imidazol-4-yl]pyridine |
| SMILES | C#C.C/C=C\C=C(/C)C(c1ccccc1)(c1ccccc1)n1cnc(-c2ccc(OC)nc2)c1 |
| InChI | InChI=1S/C28H27N3O.C2H2/c1-4-5-12-22(2)28(24-13-8-6-9-14-24,25-15-10-7-11-16-25)31-20-26(30-21-31)23-17-18-27(32-3)29-19-23;1-2/h4-21H,1-3H3;1-2H/b5-4-,22-12+; |
| InChIKey | UWCXZWKYQBNGSO-SOXMCPIRSA-N |
| XLogP | 6.52 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|