About N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane
N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane (PubChem CID 142961880) has the molecular formula C14H25ClN4
and a molecular weight of 284.84 g/mol. Its IUPAC name is N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane.
Molecular Properties
| Compound Name | N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane |
| PubChem CID | 142961880 |
| Molecular Formula | C14H25ClN4 |
| Molecular Weight | 284.84 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane |
| SMILES | CC.CN(/C=N/Cc1ccc(Cl)nc1)CCCCN |
| InChI | InChI=1S/C12H19ClN4.C2H6/c1-17(7-3-2-6-14)10-15-8-11-4-5-12(13)16-9-11;1-2/h4-5,9-10H,2-3,6-8,14H2,1H3;1-2H3/b15-10+; |
| InChIKey | TUAUQOHBXLWJMI-GYVLLFFHSA-N |
| XLogP | 2.96 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.84 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane?
The IUPAC name of N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane (CID 142961880) is N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane.
What is the SMILES notation for N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane?
The canonical SMILES for N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane is CC.CN(/C=N/Cc1ccc(Cl)nc1)CCCCN.
What is the InChIKey of N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane?
The InChIKey is TUAUQOHBXLWJMI-GYVLLFFHSA-N. The full InChI is InChI=1S/C12H19ClN4.C2H6/c1-17(7-3-2-6-14)10-15-8-11-4-5-12(13)16-9-11;1-2/h4-5,9-10H,2-3,6-8,14H2,1H3;1-2H3/b15-10+;.
What are the key properties of N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane?
N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane has a molecular weight of 284.84 g/mol, XLogP of 2.96, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminobutyl)-N'-[(6-chloro-3-pyridinyl)methyl]-N-methylmethanimidamide;ethane is sourced from PubChem (CID 142961880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).