C23H38N2O2 — CID 142962020
(2E,4E)-2,5-dimethyl-6-oxo-N-[(2E,4E)-3-piperidin-1-ylhepta-2,4-dien-4-yl]hepta-2,4-dienamide;ethane (PubChem CID 142962020) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is (2E,4E)-2,5-dimethyl-6-oxo-N-[(2E,4E)-3-piperidin-1-ylhepta-2,4-dien-4-yl]hepta-2,4-dienamide;ethane.
| Compound Name | (2E,4E)-2,5-dimethyl-6-oxo-N-[(2E,4E)-3-piperidin-1-ylhepta-2,4-dien-4-yl]hepta-2,4-dienamide;ethane |
|---|---|
| PubChem CID | 142962020 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | (2E,4E)-2,5-dimethyl-6-oxo-N-[(2E,4E)-3-piperidin-1-ylhepta-2,4-dien-4-yl]hepta-2,4-dienamide;ethane |
| SMILES | C/C=C(C(=C/CC)\NC(=O)/C(C)=C/C=C(\C)C(C)=O)/N1CCCCC1.CC |
| InChI | InChI=1S/C21H32N2O2.C2H6/c1-6-11-19(20(7-2)23-14-9-8-10-15-23)22-21(25)17(4)13-12-16(3)18(5)24;1-2/h7,11-13H,6,8-10,14-15H2,1-5H3,(H,22,25);1-2H3/b16-12+,17-13+,19-11+,20-7+; |
| InChIKey | NWNQVSYLNDVDJX-YFZAWPPCSA-N |
| XLogP | 5.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|