About methanol;(5R)-5-methyloxolan-2-amine
methanol;(5R)-5-methyloxolan-2-amine (PubChem CID 142962161) has the molecular formula C6H15NO2
and a molecular weight of 133.19 g/mol. Its IUPAC name is methanol;(5R)-5-methyloxolan-2-amine.
Molecular Properties
| Compound Name | methanol;(5R)-5-methyloxolan-2-amine |
| PubChem CID | 142962161 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | methanol;(5R)-5-methyloxolan-2-amine |
| SMILES | CO.C[C@@H]1CCC(N)O1 |
| InChI | InChI=1S/C5H11NO.CH4O/c1-4-2-3-5(6)7-4;1-2/h4-5H,2-3,6H2,1H3;2H,1H3/t4-,5?;/m1./s1 |
| InChIKey | IQIAUFLIBBWMDZ-FVYOBFAJSA-N |
| XLogP | 0.08 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanol;(5R)-5-methyloxolan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;(5R)-5-methyloxolan-2-amine?
The IUPAC name of methanol;(5R)-5-methyloxolan-2-amine (CID 142962161) is methanol;(5R)-5-methyloxolan-2-amine.
What is the SMILES notation for methanol;(5R)-5-methyloxolan-2-amine?
The canonical SMILES for methanol;(5R)-5-methyloxolan-2-amine is CO.C[C@@H]1CCC(N)O1.
What is the InChIKey of methanol;(5R)-5-methyloxolan-2-amine?
The InChIKey is IQIAUFLIBBWMDZ-FVYOBFAJSA-N. The full InChI is InChI=1S/C5H11NO.CH4O/c1-4-2-3-5(6)7-4;1-2/h4-5H,2-3,6H2,1H3;2H,1H3/t4-,5?;/m1./s1.
What are the key properties of methanol;(5R)-5-methyloxolan-2-amine?
methanol;(5R)-5-methyloxolan-2-amine has a molecular weight of 133.19 g/mol, XLogP of 0.08, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;(5R)-5-methyloxolan-2-amine is sourced from PubChem (CID 142962161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).