C17H18O4S — CID 14296283
(E)-2-(4-methylphenyl)sulfonyl-1-phenylbut-2-ene-1,4-diol (PubChem CID 14296283) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is (E)-2-(4-methylphenyl)sulfonyl-1-phenylbut-2-ene-1,4-diol.
| Compound Name | (E)-2-(4-methylphenyl)sulfonyl-1-phenylbut-2-ene-1,4-diol |
|---|---|
| PubChem CID | 14296283 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (E)-2-(4-methylphenyl)sulfonyl-1-phenylbut-2-ene-1,4-diol |
| SMILES | Cc1ccc(S(=O)(=O)/C(=C/CO)C(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18O4S/c1-13-7-9-15(10-8-13)22(20,21)16(11-12-18)17(19)14-5-3-2-4-6-14/h2-11,17-19H,12H2,1H3/b16-11+ |
| InChIKey | ARFQRSZQOZTDQV-LFIBNONCSA-N |
| XLogP | 2.38 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |