C15H22O4S — CID 14296290
(E)-2,5-dimethyl-3-(4-methylphenyl)sulfonylhex-2-ene-1,4-diol (PubChem CID 14296290) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is (E)-2,5-dimethyl-3-(4-methylphenyl)sulfonylhex-2-ene-1,4-diol.
| Compound Name | (E)-2,5-dimethyl-3-(4-methylphenyl)sulfonylhex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 14296290 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (E)-2,5-dimethyl-3-(4-methylphenyl)sulfonylhex-2-ene-1,4-diol |
| SMILES | C/C(CO)=C(/C(O)C(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H22O4S/c1-10(2)14(17)15(12(4)9-16)20(18,19)13-7-5-11(3)6-8-13/h5-8,10,14,16-17H,9H2,1-4H3/b15-12+ |
| InChIKey | BFOWFCNBXJEJBY-NTCAYCPXSA-N |
| XLogP | 2.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |