About 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol
4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol (PubChem CID 142963003) has the molecular formula C17H16N6S
and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol.
Molecular Properties
| Compound Name | 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol |
| PubChem CID | 142963003 |
| Molecular Formula | C17H16N6S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol |
| SMILES | C#CCC(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(S)cc1 |
| InChI | InChI=1S/C17H16N6S/c1-2-3-11(10-4-6-13(24)7-5-10)8-12-9-20-16-14(21-12)15(18)22-17(19)23-16/h1,4-7,9,11,24H,3,8H2,(H4,18,19,20,22,23) |
| InChIKey | ASUUKRDUTIWZQK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol?
The IUPAC name of 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol (CID 142963003) is 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol.
What is the SMILES notation for 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol?
The canonical SMILES for 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol is C#CCC(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(S)cc1.
What is the InChIKey of 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol?
The InChIKey is ASUUKRDUTIWZQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N6S/c1-2-3-11(10-4-6-13(24)7-5-10)8-12-9-20-16-14(21-12)15(18)22-17(19)23-16/h1,4-7,9,11,24H,3,8H2,(H4,18,19,20,22,23).
What are the key properties of 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol?
4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol has a molecular weight of 336.42 g/mol, XLogP of 2.22, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzenethiol is sourced from PubChem (CID 142963003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).