About 2-butoxy-4-ethylhexa-1,3-diene
2-butoxy-4-ethylhexa-1,3-diene (PubChem CID 14296314) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-butoxy-4-ethylhexa-1,3-diene.
Molecular Properties
| Compound Name | 2-butoxy-4-ethylhexa-1,3-diene |
| PubChem CID | 14296314 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2-butoxy-4-ethylhexa-1,3-diene |
| SMILES | C=C(C=C(CC)CC)OCCCC |
| InChI | InChI=1S/C12H22O/c1-5-8-9-13-11(4)10-12(6-2)7-3/h10H,4-9H2,1-3H3 |
| InChIKey | YRCWCOACUZDNNX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-4-ethylhexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-4-ethylhexa-1,3-diene?
The IUPAC name of 2-butoxy-4-ethylhexa-1,3-diene (CID 14296314) is 2-butoxy-4-ethylhexa-1,3-diene.
What is the SMILES notation for 2-butoxy-4-ethylhexa-1,3-diene?
The canonical SMILES for 2-butoxy-4-ethylhexa-1,3-diene is C=C(C=C(CC)CC)OCCCC.
What is the InChIKey of 2-butoxy-4-ethylhexa-1,3-diene?
The InChIKey is YRCWCOACUZDNNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O/c1-5-8-9-13-11(4)10-12(6-2)7-3/h10H,4-9H2,1-3H3.
What are the key properties of 2-butoxy-4-ethylhexa-1,3-diene?
2-butoxy-4-ethylhexa-1,3-diene has a molecular weight of 182.31 g/mol, XLogP of 4.06, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-4-ethylhexa-1,3-diene is sourced from PubChem (CID 14296314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).