About 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid
3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid (PubChem CID 142963598) has the molecular formula C16H23O5P
and a molecular weight of 326.33 g/mol. Its IUPAC name is 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid |
| PubChem CID | 142963598 |
| Molecular Formula | C16H23O5P |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid |
| SMILES | CCc1c(C)c(C)c(C(=O)O)c(O)c1C/C=C(\C)CP(O)O |
| InChI | InChI=1S/C16H23O5P/c1-5-12-10(3)11(4)14(16(18)19)15(17)13(12)7-6-9(2)8-22(20)21/h6,17,20-21H,5,7-8H2,1-4H3,(H,18,19)/b9-6+ |
| InChIKey | BSBPPDVPJZGDHH-RMKNXTFCSA-N |
| XLogP | 3.05 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid?
The IUPAC name of 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid (CID 142963598) is 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid.
What is the SMILES notation for 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid?
The canonical SMILES for 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid is CCc1c(C)c(C)c(C(=O)O)c(O)c1C/C=C(\C)CP(O)O.
What is the InChIKey of 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid?
The InChIKey is BSBPPDVPJZGDHH-RMKNXTFCSA-N. The full InChI is InChI=1S/C16H23O5P/c1-5-12-10(3)11(4)14(16(18)19)15(17)13(12)7-6-9(2)8-22(20)21/h6,17,20-21H,5,7-8H2,1-4H3,(H,18,19)/b9-6+.
What are the key properties of 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid?
3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid has a molecular weight of 326.33 g/mol, XLogP of 3.05, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-4-dihydroxyphosphanyl-3-methylbut-2-enyl]-4-ethyl-2-hydroxy-5,6-dimethylbenzoic acid is sourced from PubChem (CID 142963598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).