C17H28O — CID 142963770
(1S,7S,8S,8aR)-8-ethyl-1-methoxy-7-methyl-8a-propyl-2,3,7,8-tetrahydro-1H-naphthalene (PubChem CID 142963770) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (1S,7S,8S,8aR)-8-ethyl-1-methoxy-7-methyl-8a-propyl-2,3,7,8-tetrahydro-1H-naphthalene.
| Compound Name | (1S,7S,8S,8aR)-8-ethyl-1-methoxy-7-methyl-8a-propyl-2,3,7,8-tetrahydro-1H-naphthalene |
|---|---|
| PubChem CID | 142963770 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (1S,7S,8S,8aR)-8-ethyl-1-methoxy-7-methyl-8a-propyl-2,3,7,8-tetrahydro-1H-naphthalene |
| SMILES | CCC[C@@]12C(=CCC[C@@H]1OC)C=C[C@H](C)[C@@H]2CC |
| InChI | InChI=1S/C17H28O/c1-5-12-17-14(8-7-9-16(17)18-4)11-10-13(3)15(17)6-2/h8,10-11,13,15-16H,5-7,9,12H2,1-4H3/t13-,15-,16-,17-/m0/s1 |
| InChIKey | JJDHUZTWGJSDJA-HJWJTTGWSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |