About 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine
3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine (PubChem CID 14296378) has the molecular formula C4H2F6N4
and a molecular weight of 220.08 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine |
| PubChem CID | 14296378 |
| Molecular Formula | C4H2F6N4 |
| Molecular Weight | 220.08 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(C(F)(F)F)nnc1C(F)(F)F |
| InChI | InChI=1S/C4H2F6N4/c5-3(6,7)1-12-13-2(14(1)11)4(8,9)10/h11H2 |
| InChIKey | ZMFQTIZSANFKKQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.08 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine?
The IUPAC name of 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine (CID 14296378) is 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine.
What is the SMILES notation for 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine?
The canonical SMILES for 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine is Nn1c(C(F)(F)F)nnc1C(F)(F)F.
What is the InChIKey of 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine?
The InChIKey is ZMFQTIZSANFKKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2F6N4/c5-3(6,7)1-12-13-2(14(1)11)4(8,9)10/h11H2.
What are the key properties of 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine?
3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine has a molecular weight of 220.08 g/mol, XLogP of 1.03, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(trifluoromethyl)-1,2,4-triazol-4-amine is sourced from PubChem (CID 14296378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).