C16H18Cl2FNO3 — CID 142964059
4-[3-[3-(3,3-dichloroprop-2-enoxy)-4-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]butan-1-ol (PubChem CID 142964059) has the molecular formula C16H18Cl2FNO3 and a molecular weight of 362.23 g/mol. Its IUPAC name is 4-[3-[3-(3,3-dichloroprop-2-enoxy)-4-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]butan-1-ol.
| Compound Name | 4-[3-[3-(3,3-dichloroprop-2-enoxy)-4-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]butan-1-ol |
|---|---|
| PubChem CID | 142964059 |
| Molecular Formula | C16H18Cl2FNO3 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 4-[3-[3-(3,3-dichloroprop-2-enoxy)-4-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]butan-1-ol |
| SMILES | OCCCCC1CC(c2ccc(F)c(OCC=C(Cl)Cl)c2)=NO1 |
| InChI | InChI=1S/C16H18Cl2FNO3/c17-16(18)6-8-22-15-9-11(4-5-13(15)19)14-10-12(23-20-14)3-1-2-7-21/h4-6,9,12,21H,1-3,7-8,10H2 |
| InChIKey | RJVUEMUEJVGHTK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|