About cyclobutanone;4-ethylaniline
cyclobutanone;4-ethylaniline (PubChem CID 142964401) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is cyclobutanone;4-ethylaniline.
Molecular Properties
| Compound Name | cyclobutanone;4-ethylaniline |
| PubChem CID | 142964401 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | cyclobutanone;4-ethylaniline |
| SMILES | CCc1ccc(N)cc1.O=C1CCC1 |
| InChI | InChI=1S/C8H11N.C4H6O/c1-2-7-3-5-8(9)6-4-7;5-4-2-1-3-4/h3-6H,2,9H2,1H3;1-3H2 |
| InChIKey | ARPUFTVQTZCRQS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyclobutanone;4-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutanone;4-ethylaniline?
The IUPAC name of cyclobutanone;4-ethylaniline (CID 142964401) is cyclobutanone;4-ethylaniline.
What is the SMILES notation for cyclobutanone;4-ethylaniline?
The canonical SMILES for cyclobutanone;4-ethylaniline is CCc1ccc(N)cc1.O=C1CCC1.
What is the InChIKey of cyclobutanone;4-ethylaniline?
The InChIKey is ARPUFTVQTZCRQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C4H6O/c1-2-7-3-5-8(9)6-4-7;5-4-2-1-3-4/h3-6H,2,9H2,1H3;1-3H2.
What are the key properties of cyclobutanone;4-ethylaniline?
cyclobutanone;4-ethylaniline has a molecular weight of 191.27 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutanone;4-ethylaniline is sourced from PubChem (CID 142964401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).