About N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide
N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide (PubChem CID 142964491) has the molecular formula C18H19NO2S
and a molecular weight of 313.42 g/mol. Its IUPAC name is N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide.
Molecular Properties
| Compound Name | N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide |
| PubChem CID | 142964491 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide |
| SMILES | C=CC(CSC1=CC=CCC1)NC(=O)c1ccccc1C=O |
| InChI | InChI=1S/C18H19NO2S/c1-2-15(13-22-16-9-4-3-5-10-16)19-18(21)17-11-7-6-8-14(17)12-20/h2-4,6-9,11-12,15H,1,5,10,13H2,(H,19,21) |
| InChIKey | JTANFKNVZMPNEG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide?
The IUPAC name of N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide (CID 142964491) is N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide.
What is the SMILES notation for N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide?
The canonical SMILES for N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide is C=CC(CSC1=CC=CCC1)NC(=O)c1ccccc1C=O.
What is the InChIKey of N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide?
The InChIKey is JTANFKNVZMPNEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2S/c1-2-15(13-22-16-9-4-3-5-10-16)19-18(21)17-11-7-6-8-14(17)12-20/h2-4,6-9,11-12,15H,1,5,10,13H2,(H,19,21).
What are the key properties of N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide?
N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide has a molecular weight of 313.42 g/mol, XLogP of 3.75, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclohexa-1,3-dien-1-ylsulfanylbut-3-en-2-yl)-2-formylbenzamide is sourced from PubChem (CID 142964491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).