C18H24N2O6 — CID 142964766
2-[(1E,4Z,5Z)-4-ethylidene-1-(methylideneamino)-2-(methyliminomethyl)hepta-1,5-dienoxy]-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 142964766) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-[(1E,4Z,5Z)-4-ethylidene-1-(methylideneamino)-2-(methyliminomethyl)hepta-1,5-dienoxy]-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | 2-[(1E,4Z,5Z)-4-ethylidene-1-(methylideneamino)-2-(methyliminomethyl)hepta-1,5-dienoxy]-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 142964766 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-[(1E,4Z,5Z)-4-ethylidene-1-(methylideneamino)-2-(methyliminomethyl)hepta-1,5-dienoxy]-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | C=N/C(OC1OC(C(=O)O)=CC(O)C1O)=C(\C=N\C)CC(/C=C\C)=C/C |
| InChI | InChI=1S/C18H24N2O6/c1-5-7-11(6-2)8-12(10-19-3)16(20-4)26-18-15(22)13(21)9-14(25-18)17(23)24/h5-7,9-10,13,15,18,21-22H,4,8H2,1-3H3,(H,23,24)/b7-5-,11-6+,16-12+,19-10+ |
| InChIKey | NSKZAIXUOXKLEL-UPYXHLORSA-N |
| XLogP | 1.57 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|