About 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol
2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol (PubChem CID 142965144) has the molecular formula C14H23NO3
and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol.
Molecular Properties
| Compound Name | 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol |
| PubChem CID | 142965144 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol |
| SMILES | C/C(O)=C/O.C/C=C\Cc1ncccc1O.CC |
| InChI | InChI=1S/C9H11NO.C3H6O2.C2H6/c1-2-3-5-8-9(11)6-4-7-10-8;1-3(5)2-4;1-2/h2-4,6-7,11H,5H2,1H3;2,4-5H,1H3;1-2H3/b2*3-2-; |
| InChIKey | ODPLUUGSZDECQG-OZWADYBTSA-N |
| XLogP | 3.90 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol?
The IUPAC name of 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol (CID 142965144) is 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol.
What is the SMILES notation for 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol?
The canonical SMILES for 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol is C/C(O)=C/O.C/C=C\Cc1ncccc1O.CC.
What is the InChIKey of 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol?
The InChIKey is ODPLUUGSZDECQG-OZWADYBTSA-N. The full InChI is InChI=1S/C9H11NO.C3H6O2.C2H6/c1-2-3-5-8-9(11)6-4-7-10-8;1-3(5)2-4;1-2/h2-4,6-7,11H,5H2,1H3;2,4-5H,1H3;1-2H3/b2*3-2-;.
What are the key properties of 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol?
2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol has a molecular weight of 253.34 g/mol, XLogP of 3.90, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-but-2-enyl]pyridin-3-ol;ethane;(Z)-prop-1-ene-1,2-diol is sourced from PubChem (CID 142965144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).